C26H27F4NO5 — CID 10458959
[9-ethoxy-8-methoxy-6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate (PubChem CID 10458959) has the molecular formula C26H27F4NO5 and a molecular weight of 509.50 g/mol. Its IUPAC name is [9-ethoxy-8-methoxy-6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate.
| Compound Name | [9-ethoxy-8-methoxy-6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 10458959 |
| Molecular Formula | C26H27F4NO5 |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | [9-ethoxy-8-methoxy-6-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(OC(F)(F)C(F)F)cc1)=NC1CCC(OC(C)=O)CC21 |
| InChI | InChI=1S/C26H27F4NO5/c1-4-34-23-12-18-19-11-17(35-14(2)32)9-10-21(19)31-24(20(18)13-22(23)33-3)15-5-7-16(8-6-15)36-26(29,30)25(27)28/h5-8,12-13,17,19,21,25H,4,9-11H2,1-3H3 |
| InChIKey | MEXCCQZAGRBRMX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|