C44H46N6O8 — CID 67022395
bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate (PubChem CID 67022395) has the molecular formula C44H46N6O8 and a molecular weight of 786.89 g/mol. Its IUPAC name is bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 67022395 |
| Molecular Formula | C44H46N6O8 |
| Molecular Weight | 786.89 g/mol |
| Exact Mass | 786.34 |
| IUPAC Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate |
| SMILES | CCOc1cc2c(cc1OC)C(c1cncnc1)=N[C@@H]1CC[C@@H](OC(=O)/C=C/C(=O)O[C@@H]3CC[C@H]4N=C(c5cncnc5)c5cc(OC)c(OCC)cc5[C@H]4C3)C[C@H]21 |
| InChI | InChI=1S/C44H46N6O8/c1-5-55-39-15-29-31-13-27(7-9-35(31)49-43(25-19-45-23-46-20-25)33(29)17-37(39)53-3)57-41(51)11-12-42(52)58-28-8-10-36-32(14-28)30-16-40(56-6-2)38(54-4)18-34(30)44(50-36)26-21-47-24-48-22-26/h11-12,15-24,27-28,31-32,35-36H,5-10,13-14H2,1-4H3/b12-11+/t27-,28-,31-,32-,35-,36-/m1/s1 |
| InChIKey | PBANTGVSAAEWOK-ASKDDWRZSA-N |
| XLogP | 6.14 |
| TPSA | 165.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.89 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|