C46H50N6O10 — CID 67022590
bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-2-oxopyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate (PubChem CID 67022590) has the molecular formula C46H50N6O10 and a molecular weight of 846.94 g/mol. Its IUPAC name is bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-2-oxopyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-2-oxopyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 67022590 |
| Molecular Formula | C46H50N6O10 |
| Molecular Weight | 846.94 g/mol |
| Exact Mass | 846.36 |
| IUPAC Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(1-methyl-2-oxopyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] (E)-but-2-enedioate |
| SMILES | CCOc1cc2c(cc1OC)C(c1cnc(=O)n(C)c1)=N[C@@H]1CC[C@@H](OC(=O)/C=C/C(=O)O[C@@H]3CC[C@H]4N=C(c5cnc(=O)n(C)c5)c5cc(OC)c(OCC)cc5[C@H]4C3)C[C@H]21 |
| InChI | InChI=1S/C46H50N6O10/c1-7-59-39-17-29-31-15-27(9-11-35(31)49-43(33(29)19-37(39)57-5)25-21-47-45(55)51(3)23-25)61-41(53)13-14-42(54)62-28-10-12-36-32(16-28)30-18-40(60-8-2)38(58-6)20-34(30)44(50-36)26-22-48-46(56)52(4)24-26/h13-14,17-24,27-28,31-32,35-36H,7-12,15-16H2,1-6H3/b14-13+/t27-,28-,31-,32-,35-,36-/m1/s1 |
| InChIKey | HSKUROFORXTAGF-JJTSTMHNSA-N |
| XLogP | 4.74 |
| TPSA | 184.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.94 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|