C44H48N6O10 — CID 67022485
bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methoxypyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] oxalate (PubChem CID 67022485) has the molecular formula C44H48N6O10 and a molecular weight of 820.90 g/mol. Its IUPAC name is bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methoxypyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] oxalate.
| Compound Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methoxypyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] oxalate |
|---|---|
| PubChem CID | 67022485 |
| Molecular Formula | C44H48N6O10 |
| Molecular Weight | 820.90 g/mol |
| Exact Mass | 820.34 |
| IUPAC Name | bis[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(2-methoxypyrimidin-5-yl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] oxalate |
| SMILES | CCOc1cc2c(cc1OC)C(c1cnc(OC)nc1)=N[C@@H]1CC[C@@H](OC(=O)C(=O)O[C@@H]3CC[C@H]4N=C(c5cnc(OC)nc5)c5cc(OC)c(OCC)cc5[C@H]4C3)C[C@H]21 |
| InChI | InChI=1S/C44H48N6O10/c1-7-57-37-15-27-29-13-25(9-11-33(29)49-39(31(27)17-35(37)53-3)23-19-45-43(55-5)46-20-23)59-41(51)42(52)60-26-10-12-34-30(14-26)28-16-38(58-8-2)36(54-4)18-32(28)40(50-34)24-21-47-44(56-6)48-22-24/h15-22,25-26,29-30,33-34H,7-14H2,1-6H3/t25-,26-,29-,30-,33-,34-/m1/s1 |
| InChIKey | ULIOATWGCMDGIZ-NAPRTJEYSA-N |
| XLogP | 5.60 |
| TPSA | 184.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|