C24H30N2O6S — CID 142691363
[(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(6-methoxy-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] ethanesulfonate (PubChem CID 142691363) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is [(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(6-methoxy-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] ethanesulfonate.
| Compound Name | [(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(6-methoxy-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] ethanesulfonate |
|---|---|
| PubChem CID | 142691363 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-(6-methoxy-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] ethanesulfonate |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(OC)nc1)=N[C@@H]1CC[C@@H](OS(=O)(=O)CC)C[C@H]21 |
| InChI | InChI=1S/C24H30N2O6S/c1-5-31-22-12-17-18-11-16(32-33(27,28)6-2)8-9-20(18)26-24(19(17)13-21(22)29-3)15-7-10-23(30-4)25-14-15/h7,10,12-14,16,18,20H,5-6,8-9,11H2,1-4H3/t16-,18-,20-/m1/s1 |
| InChIKey | ZAORPBUXJPDVGM-YVWKXTFCSA-N |
| XLogP | 3.72 |
| TPSA | 96.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|