C25H31N3O4 — CID 11669287
9-ethoxy-8-methoxy-6-(6-morpholin-4-yl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 11669287) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 9-ethoxy-8-methoxy-6-(6-morpholin-4-yl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | 9-ethoxy-8-methoxy-6-(6-morpholin-4-yl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 11669287 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 9-ethoxy-8-methoxy-6-(6-morpholin-4-yl-3-pyridinyl)-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(N3CCOCC3)nc1)=NC1CCC(O)CC21 |
| InChI | InChI=1S/C25H31N3O4/c1-3-32-23-13-18-19-12-17(29)5-6-21(19)27-25(20(18)14-22(23)30-2)16-4-7-24(26-15-16)28-8-10-31-11-9-28/h4,7,13-15,17,19,21,29H,3,5-6,8-12H2,1-2H3 |
| InChIKey | GBFPMXWXWRGEHG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |