C29H36N2O4 — CID 11155789
[4-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 11155789) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is [4-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [4-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 11155789 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | [4-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(C(=O)C3CCN(C)CC3)cc1)=NC1CCC(O)CC21 |
| InChI | InChI=1S/C29H36N2O4/c1-4-35-27-16-22-23-15-21(32)9-10-25(23)30-28(24(22)17-26(27)34-3)18-5-7-19(8-6-18)29(33)20-11-13-31(2)14-12-20/h5-8,16-17,20-21,23,25,32H,4,9-15H2,1-3H3 |
| InChIKey | YVTCGYWNVPIQHE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |