C26H30N2O4 — CID 11419129
N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]cyclopropanecarboxamide (PubChem CID 11419129) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 11419129 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]cyclopropanecarboxamide |
| SMILES | CCOc1cc2c(cc1OC)C(c1cccc(NC(=O)C3CC3)c1)=NC1CCC(O)CC21 |
| InChI | InChI=1S/C26H30N2O4/c1-3-32-24-13-19-20-12-18(29)9-10-22(20)28-25(21(19)14-23(24)31-2)16-5-4-6-17(11-16)27-26(30)15-7-8-15/h4-6,11,13-15,18,20,22,29H,3,7-10,12H2,1-2H3,(H,27,30) |
| InChIKey | ROMNXRPWLQQSNH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |