C28H37N3O4 — CID 69458183
2-(dimethylamino)-N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]butanamide (PubChem CID 69458183) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]butanamide.
| Compound Name | 2-(dimethylamino)-N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 69458183 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 2-(dimethylamino)-N-[3-(9-ethoxy-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl)phenyl]butanamide |
| SMILES | CCOc1cc2c(cc1OC)C(c1cccc(NC(=O)C(CC)N(C)C)c1)=NC1CCC(O)CC21 |
| InChI | InChI=1S/C28H37N3O4/c1-6-24(31(3)4)28(33)29-18-10-8-9-17(13-18)27-22-16-25(34-5)26(35-7-2)15-20(22)21-14-19(32)11-12-23(21)30-27/h8-10,13,15-16,19,21,23-24,32H,6-7,11-12,14H2,1-5H3,(H,29,33) |
| InChIKey | HYVWIZBUHDYWGY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |