C27H33N3O4 — CID 59006935
[4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-pyrano[4,3-c]isoquinolin-6-yl]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 59006935) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is [4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-pyrano[4,3-c]isoquinolin-6-yl]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-pyrano[4,3-c]isoquinolin-6-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 59006935 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | [4-[(4aR,10bR)-9-ethoxy-8-methoxy-3,4,4a,10b-tetrahydro-1H-pyrano[4,3-c]isoquinolin-6-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(C(=O)N3CCN(C)CC3)cc1)=N[C@@H]1CCOC[C@H]21 |
| InChI | InChI=1S/C27H33N3O4/c1-4-34-25-15-20-21(16-24(25)32-3)26(28-23-9-14-33-17-22(20)23)18-5-7-19(8-6-18)27(31)30-12-10-29(2)11-13-30/h5-8,15-16,22-23H,4,9-14,17H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | ZAOQPOXLIMOWEN-DHIUTWEWSA-N |
| XLogP | 3.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |