C32H40F2N4O4 — CID 69295955
[4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]methanone (PubChem CID 69295955) has the molecular formula C32H40F2N4O4 and a molecular weight of 582.69 g/mol. Its IUPAC name is [4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]methanone.
| Compound Name | [4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 69295955 |
| Molecular Formula | C32H40F2N4O4 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | [4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]methanone |
| SMILES | COc1cc2c(cc1OC(F)F)[C@H]1CCCC[C@H]1N=C2c1ccc(C(=O)N2CCN(CCN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C32H40F2N4O4/c1-40-28-21-26-25(20-29(28)42-32(33)34)24-4-2-3-5-27(24)35-30(26)22-6-8-23(9-7-22)31(39)38-14-12-36(13-15-38)10-11-37-16-18-41-19-17-37/h6-9,20-21,24,27,32H,2-5,10-19H2,1H3/t24-,27-/m1/s1 |
| InChIKey | HXALQROLBDXJCW-SHQCIBLASA-N |
| XLogP | 4.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |