C29H35F2N3O4 — CID 69298368
4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-(3-morpholin-3-ylpropyl)benzamide (PubChem CID 69298368) has the molecular formula C29H35F2N3O4 and a molecular weight of 527.61 g/mol. Its IUPAC name is 4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-(3-morpholin-3-ylpropyl)benzamide.
| Compound Name | 4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-(3-morpholin-3-ylpropyl)benzamide |
|---|---|
| PubChem CID | 69298368 |
| Molecular Formula | C29H35F2N3O4 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 4-[(4aR,10bR)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-(3-morpholin-3-ylpropyl)benzamide |
| SMILES | COc1cc2c(cc1OC(F)F)[C@H]1CCCC[C@H]1N=C2c1ccc(C(=O)NCCCC2COCCN2)cc1 |
| InChI | InChI=1S/C29H35F2N3O4/c1-36-25-16-23-22(15-26(25)38-29(30)31)21-6-2-3-7-24(21)34-27(23)18-8-10-19(11-9-18)28(35)33-12-4-5-20-17-37-14-13-32-20/h8-11,15-16,20-21,24,29,32H,2-7,12-14,17H2,1H3,(H,33,35)/t20?,21-,24-/m1/s1 |
| InChIKey | DPGFKWVQUPYQMQ-RKSSIALMSA-N |
| XLogP | 4.67 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|