C25H26F2N2O4 — CID 11259600
4-[(2R,4aR,10bR)-9-(difluoromethoxy)-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-cyclopropylbenzamide (PubChem CID 11259600) has the molecular formula C25H26F2N2O4 and a molecular weight of 456.49 g/mol. Its IUPAC name is 4-[(2R,4aR,10bR)-9-(difluoromethoxy)-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-cyclopropylbenzamide.
| Compound Name | 4-[(2R,4aR,10bR)-9-(difluoromethoxy)-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 11259600 |
| Molecular Formula | C25H26F2N2O4 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-[(2R,4aR,10bR)-9-(difluoromethoxy)-2-hydroxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]-N-cyclopropylbenzamide |
| SMILES | COc1cc2c(cc1OC(F)F)[C@H]1C[C@H](O)CC[C@H]1N=C2c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C25H26F2N2O4/c1-32-21-12-19-17(11-22(21)33-25(26)27)18-10-16(30)8-9-20(18)29-23(19)13-2-4-14(5-3-13)24(31)28-15-6-7-15/h2-5,11-12,15-16,18,20,25,30H,6-10H2,1H3,(H,28,31)/t16-,18-,20-/m1/s1 |
| InChIKey | NVFYVOYKTAOECP-YVWKXTFCSA-N |
| XLogP | 4.04 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |