C26H27F2N5O4 — CID 140518314
[8-(difluoromethoxy)-6-[4-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate (PubChem CID 140518314) has the molecular formula C26H27F2N5O4 and a molecular weight of 511.53 g/mol. Its IUPAC name is [8-(difluoromethoxy)-6-[4-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate.
| Compound Name | [8-(difluoromethoxy)-6-[4-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 140518314 |
| Molecular Formula | C26H27F2N5O4 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | [8-(difluoromethoxy)-6-[4-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
| SMILES | CCn1nnc(-c2ccc(C3=NC4CCC(OC(C)=O)CC4c4cc(OC)c(OC(F)F)cc43)cc2)n1 |
| InChI | InChI=1S/C26H27F2N5O4/c1-4-33-31-25(30-32-33)16-7-5-15(6-8-16)24-20-13-23(37-26(27)28)22(35-3)12-18(20)19-11-17(36-14(2)34)9-10-21(19)29-24/h5-8,12-13,17,19,21,26H,4,9-11H2,1-3H3 |
| InChIKey | QRFNSXZBOBZLLD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |