C29H38N6O2 — CID 70022894
(4aR,10bS)-9-ethoxy-6-[4-(2-hexyltetrazol-5-yl)phenyl]-8-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine (PubChem CID 70022894) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is (4aR,10bS)-9-ethoxy-6-[4-(2-hexyltetrazol-5-yl)phenyl]-8-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine.
| Compound Name | (4aR,10bS)-9-ethoxy-6-[4-(2-hexyltetrazol-5-yl)phenyl]-8-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine |
|---|---|
| PubChem CID | 70022894 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (4aR,10bS)-9-ethoxy-6-[4-(2-hexyltetrazol-5-yl)phenyl]-8-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine |
| SMILES | CCCCCCn1nnc(-c2ccc(C3=N[C@@H]4CCN(C)C[C@@H]4c4cc(OCC)c(OC)cc43)cc2)n1 |
| InChI | InChI=1S/C29H38N6O2/c1-5-7-8-9-15-35-32-29(31-33-35)21-12-10-20(11-13-21)28-23-18-26(36-4)27(37-6-2)17-22(23)24-19-34(3)16-14-25(24)30-28/h10-13,17-18,24-25H,5-9,14-16,19H2,1-4H3/t24-,25-/m1/s1 |
| InChIKey | AKIFCPNOPKJCFJ-JWQCQUIFSA-N |
| XLogP | 4.97 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|