C25H30N6O2 — CID 20637975
(4aR,10bS)-8-ethoxy-6-[3-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine (PubChem CID 20637975) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is (4aR,10bS)-8-ethoxy-6-[3-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine.
| Compound Name | (4aR,10bS)-8-ethoxy-6-[3-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine |
|---|---|
| PubChem CID | 20637975 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (4aR,10bS)-8-ethoxy-6-[3-(2-ethyltetrazol-5-yl)phenyl]-9-methoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridine |
| SMILES | CCOc1cc2c(cc1OC)[C@H]1CN(C)CC[C@H]1N=C2c1cccc(-c2nnn(CC)n2)c1 |
| InChI | InChI=1S/C25H30N6O2/c1-5-31-28-25(27-29-31)17-9-7-8-16(12-17)24-19-14-23(33-6-2)22(32-4)13-18(19)20-15-30(3)11-10-21(20)26-24/h7-9,12-14,20-21H,5-6,10-11,15H2,1-4H3/t20-,21-/m1/s1 |
| InChIKey | PXCZXOVQEWBYCQ-NHCUHLMSSA-N |
| XLogP | 3.41 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |