C25H29N5O3 — CID 11503257
8,9-dimethoxy-6-[4-(2-propyltetrazol-5-yl)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 11503257) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 8,9-dimethoxy-6-[4-(2-propyltetrazol-5-yl)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | 8,9-dimethoxy-6-[4-(2-propyltetrazol-5-yl)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 11503257 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 8,9-dimethoxy-6-[4-(2-propyltetrazol-5-yl)phenyl]-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | CCCn1nnc(-c2ccc(C3=NC4CCC(O)CC4c4cc(OC)c(OC)cc43)cc2)n1 |
| InChI | InChI=1S/C25H29N5O3/c1-4-11-30-28-25(27-29-30)16-7-5-15(6-8-16)24-20-14-23(33-3)22(32-2)13-18(20)19-12-17(31)9-10-21(19)26-24/h5-8,13-14,17,19,21,31H,4,9-12H2,1-3H3 |
| InChIKey | NGYWRRIFHRYUMJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |