C21H19F2N3O4 — CID 67340978
6-(2,1,3-benzoxadiazol-5-yl)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 67340978) has the molecular formula C21H19F2N3O4 and a molecular weight of 415.40 g/mol. Its IUPAC name is 6-(2,1,3-benzoxadiazol-5-yl)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | 6-(2,1,3-benzoxadiazol-5-yl)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 67340978 |
| Molecular Formula | C21H19F2N3O4 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 6-(2,1,3-benzoxadiazol-5-yl)-9-(difluoromethoxy)-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | COc1cc2c(cc1OC(F)F)C1CC(O)CCC1N=C2c1ccc2nonc2c1 |
| InChI | InChI=1S/C21H19F2N3O4/c1-28-18-9-14-12(8-19(18)29-21(22)23)13-7-11(27)3-5-15(13)24-20(14)10-2-4-16-17(6-10)26-30-25-16/h2,4,6,8-9,11,13,15,21,27H,3,5,7H2,1H3 |
| InChIKey | LKBWUOUOMTZGJU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |