C25H23F6NO6 — CID 10347444
[6-[3,4-bis(difluoromethoxy)phenyl]-8-(difluoromethoxy)-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate (PubChem CID 10347444) has the molecular formula C25H23F6NO6 and a molecular weight of 547.45 g/mol. Its IUPAC name is [6-[3,4-bis(difluoromethoxy)phenyl]-8-(difluoromethoxy)-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate.
| Compound Name | [6-[3,4-bis(difluoromethoxy)phenyl]-8-(difluoromethoxy)-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 10347444 |
| Molecular Formula | C25H23F6NO6 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | [6-[3,4-bis(difluoromethoxy)phenyl]-8-(difluoromethoxy)-9-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
| SMILES | COc1cc2c(cc1OC(F)F)C(c1ccc(OC(F)F)c(OC(F)F)c1)=NC1CCC(OC(C)=O)CC21 |
| InChI | InChI=1S/C25H23F6NO6/c1-11(33)35-13-4-5-17-15(8-13)14-9-19(34-2)21(38-25(30)31)10-16(14)22(32-17)12-3-6-18(36-23(26)27)20(7-12)37-24(28)29/h3,6-7,9-10,13,15,17,23-25H,4-5,8H2,1-2H3 |
| InChIKey | BYVBICCTOCPDJE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |