C25H30N2O6 — CID 67023839
[6-(2,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate (PubChem CID 67023839) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is [6-(2,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate.
| Compound Name | [6-(2,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 67023839 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [6-(2,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] acetate |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(OC)nc1OC)=NC1CCC(OC(C)=O)CC21 |
| InChI | InChI=1S/C25H30N2O6/c1-6-32-22-12-17-18-11-15(33-14(2)28)7-9-20(18)26-24(19(17)13-21(22)29-3)16-8-10-23(30-4)27-25(16)31-5/h8,10,12-13,15,18,20H,6-7,9,11H2,1-5H3 |
| InChIKey | MGVCUQWCZGACFF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |