C24H28N2O6 — CID 150490133
2-[6-(2,6-dimethoxy-3-pyridinyl)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl]acetic acid (PubChem CID 150490133) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[6-(2,6-dimethoxy-3-pyridinyl)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl]acetic acid.
| Compound Name | 2-[6-(2,6-dimethoxy-3-pyridinyl)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl]acetic acid |
|---|---|
| PubChem CID | 150490133 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[6-(2,6-dimethoxy-3-pyridinyl)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl]acetic acid |
| SMILES | COc1ccc(C2=NC3CCC(CC(=O)O)CC3c3cc(OC)c(OC)cc32)c(OC)n1 |
| InChI | InChI=1S/C24H28N2O6/c1-29-19-11-15-16-9-13(10-22(27)28)5-7-18(16)25-23(17(15)12-20(19)30-2)14-6-8-21(31-3)26-24(14)32-4/h6,8,11-13,16,18H,5,7,9-10H2,1-4H3,(H,27,28) |
| InChIKey | HVPWXIKLAQNNIO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |