C28H34N2O10 — CID 11854770
(2R,4aR,10bR)-6-(4,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid (PubChem CID 11854770) has the molecular formula C28H34N2O10 and a molecular weight of 558.58 g/mol. Its IUPAC name is (2R,4aR,10bR)-6-(4,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid.
| Compound Name | (2R,4aR,10bR)-6-(4,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid |
|---|---|
| PubChem CID | 11854770 |
| Molecular Formula | C28H34N2O10 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (2R,4aR,10bR)-6-(4,6-dimethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid |
| SMILES | CCOc1cc2c(cc1OC)C(c1cnc(OC)cc1OC)=N[C@@H]1CC[C@@H](O)C[C@H]21.O=C(O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C23H28N2O5.C5H6O5/c1-5-30-21-9-14-15-8-13(26)6-7-18(15)25-23(16(14)10-20(21)28-3)17-12-24-22(29-4)11-19(17)27-2;6-3(5(9)10)1-2-4(7)8/h9-13,15,18,26H,5-8H2,1-4H3;1-2H2,(H,7,8)(H,9,10)/t13-,15-,18-;/m1./s1 |
| InChIKey | GSQYNVCNKIWENP-ZRCLMYKLSA-N |
| XLogP | 2.86 |
| TPSA | 174.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|