C25H29N3O8 — CID 11855024
(2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrazin-2-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid (PubChem CID 11855024) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is (2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrazin-2-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid.
| Compound Name | (2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrazin-2-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid |
|---|---|
| PubChem CID | 11855024 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (2R,4aR,10bR)-9-ethoxy-8-methoxy-6-pyrazin-2-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid |
| SMILES | CCOc1cc2c(cc1OC)C(c1cnccn1)=N[C@@H]1CC[C@@H](O)C[C@H]21.O=C(O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C20H23N3O3.C5H6O5/c1-3-26-19-9-13-14-8-12(24)4-5-16(14)23-20(15(13)10-18(19)25-2)17-11-21-6-7-22-17;6-3(5(9)10)1-2-4(7)8/h6-7,9-12,14,16,24H,3-5,8H2,1-2H3;1-2H2,(H,7,8)(H,9,10)/t12-,14-,16-;/m1./s1 |
| InChIKey | IJYCDNOGIMJZLD-SWIBHXKKSA-N |
| XLogP | 2.24 |
| TPSA | 168.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|