C22H27N3O5 — CID 11654535
6-(2,6-dimethoxypyrimidin-4-yl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 11654535) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 6-(2,6-dimethoxypyrimidin-4-yl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | 6-(2,6-dimethoxypyrimidin-4-yl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 11654535 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 6-(2,6-dimethoxypyrimidin-4-yl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | CCOc1cc2c(cc1OC)C(c1cc(OC)nc(OC)n1)=NC1CCC(O)CC21 |
| InChI | InChI=1S/C22H27N3O5/c1-5-30-19-9-13-14-8-12(26)6-7-16(14)23-21(15(13)10-18(19)27-2)17-11-20(28-3)25-22(24-17)29-4/h9-12,14,16,26H,5-8H2,1-4H3 |
| InChIKey | QTKZOZQWJBQNOW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |