C35H40N4O4 — CID 87927952
2-[(Z)-1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethylideneamino]oxy-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 87927952) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is 2-[(Z)-1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethylideneamino]oxy-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(Z)-1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethylideneamino]oxy-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 87927952 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 2-[(Z)-1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]ethylideneamino]oxy-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | COc1cc2c(cc1OC)[C@H]1CCCC[C@H]1N=C2c1ccc(/C(C)=N\OCC(=O)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C35H40N4O4/c1-24(37-43-23-34(40)39-19-17-38(18-20-39)27-9-5-4-6-10-27)25-13-15-26(16-14-25)35-30-22-33(42-3)32(41-2)21-29(30)28-11-7-8-12-31(28)36-35/h4-6,9-10,13-16,21-22,28,31H,7-8,11-12,17-20,23H2,1-3H3/b37-24-/t28-,31-/m1/s1 |
| InChIKey | PENUOFMFIFNBKK-QDOMUYIGSA-N |
| XLogP | 5.67 |
| TPSA | 75.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|