C26H33N3O2 — CID 25178930
2-[(4aS,10bS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 25178930) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[(4aS,10bS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(4aS,10bS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 25178930 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 2-[(4aS,10bS)-7-methoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | COc1cccc2c1CC[C@H]1[C@H]2CCCN1CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33N3O2/c1-31-25-11-5-9-21-22-10-6-14-29(24(22)13-12-23(21)25)19-26(30)28-17-15-27(16-18-28)20-7-3-2-4-8-20/h2-5,7-9,11,22,24H,6,10,12-19H2,1H3/t22-,24-/m0/s1 |
| InChIKey | LCLGQOYVZHNRGO-UPVQGACJSA-N |
| XLogP | 3.54 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |