C32H39N3O4S — CID 142801517
N-[4-(8,9-diethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]-4-ethylcyclohepta-1,3,5-triene-1-sulfonamide (PubChem CID 142801517) has the molecular formula C32H39N3O4S and a molecular weight of 561.75 g/mol. Its IUPAC name is N-[4-(8,9-diethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]-4-ethylcyclohepta-1,3,5-triene-1-sulfonamide.
| Compound Name | N-[4-(8,9-diethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]-4-ethylcyclohepta-1,3,5-triene-1-sulfonamide |
|---|---|
| PubChem CID | 142801517 |
| Molecular Formula | C32H39N3O4S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | N-[4-(8,9-diethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]-4-ethylcyclohepta-1,3,5-triene-1-sulfonamide |
| SMILES | CCOc1cc2c(cc1OCC)C1CN(C)CCC1N=C2c1ccc(NS(=O)(=O)C2=CC=C(CC)C=CC2)cc1 |
| InChI | InChI=1S/C32H39N3O4S/c1-5-22-9-8-10-25(16-11-22)40(36,37)34-24-14-12-23(13-15-24)32-27-20-31(39-7-3)30(38-6-2)19-26(27)28-21-35(4)18-17-29(28)33-32/h8-9,11-16,19-20,28-29,34H,5-7,10,17-18,21H2,1-4H3 |
| InChIKey | PTNYKBIAGKHEJC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |