C31H35N3O11 — CID 69049526
bis((Z)-but-2-enedioic acid);N-[4-(8,9-dimethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]acetamide (PubChem CID 69049526) has the molecular formula C31H35N3O11 and a molecular weight of 625.63 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);N-[4-(8,9-dimethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]acetamide.
| Compound Name | bis((Z)-but-2-enedioic acid);N-[4-(8,9-dimethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 69049526 |
| Molecular Formula | C31H35N3O11 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);N-[4-(8,9-dimethoxy-2-methyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)phenyl]acetamide |
| SMILES | COc1cc2c(cc1OC)C1CN(C)CCC1N=C2c1ccc(NC(C)=O)cc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H27N3O3.2C4H4O4/c1-14(27)24-16-7-5-15(6-8-16)23-18-12-22(29-4)21(28-3)11-17(18)19-13-26(2)10-9-20(19)25-23;2*5-3(6)1-2-4(7)8/h5-8,11-12,19-20H,9-10,13H2,1-4H3,(H,24,27);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | BWJFLHODOYZAML-SPIKMXEPSA-N |
| XLogP | 2.72 |
| TPSA | 212.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|