C25H29NO4 — CID 70239536
methyl 3-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoate (PubChem CID 70239536) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is methyl 3-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoate.
| Compound Name | methyl 3-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoate |
|---|---|
| PubChem CID | 70239536 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | methyl 3-[(4aR,10bR)-8,9-diethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]benzoate |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1CCCC[C@H]1N=C2c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H29NO4/c1-4-29-22-14-19-18-11-6-7-12-21(18)26-24(20(19)15-23(22)30-5-2)16-9-8-10-17(13-16)25(27)28-3/h8-10,13-15,18,21H,4-7,11-12H2,1-3H3/t18-,21-/m1/s1 |
| InChIKey | YNBDIVSBPAOIKC-WIYYLYMNSA-N |
| XLogP | 5.15 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |