C21H33NO — CID 167018559
N-[[(4bS,8aS,9S)-3-methoxy-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]methyl]butan-1-amine (PubChem CID 167018559) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is N-[[(4bS,8aS,9S)-3-methoxy-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]methyl]butan-1-amine.
| Compound Name | N-[[(4bS,8aS,9S)-3-methoxy-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 167018559 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | N-[[(4bS,8aS,9S)-3-methoxy-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]methyl]butan-1-amine |
| SMILES | CCCCNC[C@H]1Cc2ccc(OC)cc2[C@@]2(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C21H33NO/c1-4-5-12-22-15-17-13-16-9-10-18(23-3)14-20(16)21(2)11-7-6-8-19(17)21/h9-10,14,17,19,22H,4-8,11-13,15H2,1-3H3/t17-,19+,21+/m1/s1 |
| InChIKey | DUUZVGJGWPZRHJ-LMNJBCLMSA-N |
| XLogP | 4.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|