C19H27NO4 — CID 155150970
methyl 15-(hydroxyamino)-4-methoxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2,4,6-triene-6-carboxylate (PubChem CID 155150970) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl 15-(hydroxyamino)-4-methoxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2,4,6-triene-6-carboxylate.
| Compound Name | methyl 15-(hydroxyamino)-4-methoxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2,4,6-triene-6-carboxylate |
|---|---|
| PubChem CID | 155150970 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | methyl 15-(hydroxyamino)-4-methoxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2,4,6-triene-6-carboxylate |
| SMILES | COC(=O)c1cc(OC)cc2c1CC1CCCCCC2(C)C1NO |
| InChI | InChI=1S/C19H27NO4/c1-19-8-6-4-5-7-12(17(19)20-22)9-14-15(18(21)24-3)10-13(23-2)11-16(14)19/h10-12,17,20,22H,4-9H2,1-3H3 |
| InChIKey | DMOMSBCCCIUBSG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|