C18H26N2O2 — CID 24836315
[(3aS,8bR)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-propylcarbamate (PubChem CID 24836315) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [(3aS,8bR)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-propylcarbamate.
| Compound Name | [(3aS,8bR)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 24836315 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [(3aS,8bR)-3-ethyl-8b-methyl-1,2,3a,4-tetrahydroindeno[2,1-b]pyrrol-7-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccc2c(c1)[C@@]1(C)CCN(CC)[C@H]1C2 |
| InChI | InChI=1S/C18H26N2O2/c1-4-9-19-17(21)22-14-7-6-13-11-16-18(3,15(13)12-14)8-10-20(16)5-2/h6-7,12,16H,4-5,8-11H2,1-3H3,(H,19,21)/t16-,18+/m0/s1 |
| InChIKey | XAWCVUBHVCUDBZ-FUHWJXTLSA-N |
| XLogP | 3.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |