C20H27NO — CID 98522553
(1S,9R,10R)-4-methoxy-12,13,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene (PubChem CID 98522553) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (1S,9R,10R)-4-methoxy-12,13,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene.
| Compound Name | (1S,9R,10R)-4-methoxy-12,13,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene |
|---|---|
| PubChem CID | 98522553 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (1S,9R,10R)-4-methoxy-12,13,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene |
| SMILES | COc1ccc2c(c1)[C@@]13CCN(C)[C@H](C2)[C@@H]1CC(C)=C(C)C3 |
| InChI | InChI=1S/C20H27NO/c1-13-9-18-19-10-15-5-6-16(22-4)11-17(15)20(18,12-14(13)2)7-8-21(19)3/h5-6,11,18-19H,7-10,12H2,1-4H3/t18-,19+,20-/m0/s1 |
| InChIKey | OYGGFLRVKPKVSI-ZCNNSNEGSA-N |
| XLogP | 3.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|