C14H15F3N2O3 — CID 118195749
5-(trifluoromethoxy)spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylic acid (PubChem CID 118195749) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 5-(trifluoromethoxy)spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylic acid.
| Compound Name | 5-(trifluoromethoxy)spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylic acid |
|---|---|
| PubChem CID | 118195749 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 5-(trifluoromethoxy)spiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylic acid |
| SMILES | O=C(O)N1CCC2(CC1)CNc1ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C14H15F3N2O3/c15-14(16,17)22-9-1-2-11-10(7-9)13(8-18-11)3-5-19(6-4-13)12(20)21/h1-2,7,18H,3-6,8H2,(H,20,21) |
| InChIKey | INHJRQJCTBDHQU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|