C21H20ClF3N4O4 — CID 118195805
1-[(2-chloro-4-pyridinyl)-methylcarbamoyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1'-carboxylic acid (PubChem CID 118195805) has the molecular formula C21H20ClF3N4O4 and a molecular weight of 484.86 g/mol. Its IUPAC name is 1-[(2-chloro-4-pyridinyl)-methylcarbamoyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1'-carboxylic acid.
| Compound Name | 1-[(2-chloro-4-pyridinyl)-methylcarbamoyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1'-carboxylic acid |
|---|---|
| PubChem CID | 118195805 |
| Molecular Formula | C21H20ClF3N4O4 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 1-[(2-chloro-4-pyridinyl)-methylcarbamoyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1'-carboxylic acid |
| SMILES | CN(C(=O)N1CC2(CCN(C(=O)O)CC2)c2cc(OC(F)(F)F)ccc21)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C21H20ClF3N4O4/c1-27(13-4-7-26-17(22)10-13)18(30)29-12-20(5-8-28(9-6-20)19(31)32)15-11-14(2-3-16(15)29)33-21(23,24)25/h2-4,7,10-11H,5-6,8-9,12H2,1H3,(H,31,32) |
| InChIKey | LMQHNQTZYNTAQS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|