C27H27Cl2N3O2 — CID 53344848
[5-chloro-1'-[2-(4-methylphenoxy)ethyl]spiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone (PubChem CID 53344848) has the molecular formula C27H27Cl2N3O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is [5-chloro-1'-[2-(4-methylphenoxy)ethyl]spiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone.
| Compound Name | [5-chloro-1'-[2-(4-methylphenoxy)ethyl]spiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 53344848 |
| Molecular Formula | C27H27Cl2N3O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [5-chloro-1'-[2-(4-methylphenoxy)ethyl]spiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone |
| SMILES | Cc1ccc(OCCN2CCC3(CC2)CN(C(=O)c2ccnc(Cl)c2)c2ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C27H27Cl2N3O2/c1-19-2-5-22(6-3-19)34-15-14-31-12-9-27(10-13-31)18-32(24-7-4-21(28)17-23(24)27)26(33)20-8-11-30-25(29)16-20/h2-8,11,16-17H,9-10,12-15,18H2,1H3 |
| InChIKey | DSLJWMVINAWAAI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|