C18H19ClN3O+ — CID 58046543
(2-chloro-4-pyridinyl)-spiro[2H-indole-3,4'-piperidin-1-ium]-1-ylmethanone (PubChem CID 58046543) has the molecular formula C18H19ClN3O+ and a molecular weight of 328.82 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-spiro[2H-indole-3,4'-piperidin-1-ium]-1-ylmethanone.
| Compound Name | (2-chloro-4-pyridinyl)-spiro[2H-indole-3,4'-piperidin-1-ium]-1-ylmethanone |
|---|---|
| PubChem CID | 58046543 |
| Molecular Formula | C18H19ClN3O+ |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (2-chloro-4-pyridinyl)-spiro[2H-indole-3,4'-piperidin-1-ium]-1-ylmethanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CC2(CC[NH2+]CC2)c2ccccc21 |
| InChI | InChI=1S/C18H18ClN3O/c19-16-11-13(5-8-21-16)17(23)22-12-18(6-9-20-10-7-18)14-3-1-2-4-15(14)22/h1-5,8,11,20H,6-7,9-10,12H2/p+1 |
| InChIKey | PERSMMDWOAYJAE-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|