C28H24Cl2N4O — CID 58046566
[1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-isocyanospiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone (PubChem CID 58046566) has the molecular formula C28H24Cl2N4O and a molecular weight of 503.43 g/mol. Its IUPAC name is [1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-isocyanospiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone.
| Compound Name | [1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-isocyanospiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 58046566 |
| Molecular Formula | C28H24Cl2N4O |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-isocyanospiro[2H-indole-3,4'-piperidine]-1-yl]-(2-chloro-4-pyridinyl)methanone |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(CCN(C/C=C/c3ccc(Cl)cc3)CC1)CN2C(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C28H24Cl2N4O/c1-31-23-8-9-25-24(18-23)28(19-34(25)27(35)21-10-13-32-26(30)17-21)11-15-33(16-12-28)14-2-3-20-4-6-22(29)7-5-20/h2-10,13,17-18H,11-12,14-16,19H2/b3-2+ |
| InChIKey | YEHXRZNXAQMHQW-NSCUHMNNSA-N |
| XLogP | 6.65 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|