C28H22Cl2F5N3O — CID 53346058
(2-chloro-6-methyl-4-pyridinyl)-[5-chloro-1'-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]spiro[2H-indole-3,4'-piperidine]-1-yl]methanone (PubChem CID 53346058) has the molecular formula C28H22Cl2F5N3O and a molecular weight of 582.40 g/mol. Its IUPAC name is (2-chloro-6-methyl-4-pyridinyl)-[5-chloro-1'-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]spiro[2H-indole-3,4'-piperidine]-1-yl]methanone.
| Compound Name | (2-chloro-6-methyl-4-pyridinyl)-[5-chloro-1'-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
|---|---|
| PubChem CID | 53346058 |
| Molecular Formula | C28H22Cl2F5N3O |
| Molecular Weight | 582.40 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | (2-chloro-6-methyl-4-pyridinyl)-[5-chloro-1'-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CC3(CCN(C/C=C/c4c(F)c(F)c(F)c(F)c4F)CC3)c3cc(Cl)ccc32)cc(Cl)n1 |
| InChI | InChI=1S/C28H22Cl2F5N3O/c1-15-11-16(12-21(30)36-15)27(39)38-14-28(19-13-17(29)4-5-20(19)38)6-9-37(10-7-28)8-2-3-18-22(31)24(33)26(35)25(34)23(18)32/h2-5,11-13H,6-10,14H2,1H3/b3-2+ |
| InChIKey | FSTHSUHLUITXND-NSCUHMNNSA-N |
| XLogP | 7.10 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.40 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|