C28H27ClN2O — CID 58641839
(2-chloro-4-pyridinyl)-[4'-[(E)-3-phenylprop-2-enyl]spiro[2H-indole-3,1'-cyclohexane]-1-yl]methanone (PubChem CID 58641839) has the molecular formula C28H27ClN2O and a molecular weight of 442.99 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[4'-[(E)-3-phenylprop-2-enyl]spiro[2H-indole-3,1'-cyclohexane]-1-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[4'-[(E)-3-phenylprop-2-enyl]spiro[2H-indole-3,1'-cyclohexane]-1-yl]methanone |
|---|---|
| PubChem CID | 58641839 |
| Molecular Formula | C28H27ClN2O |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[4'-[(E)-3-phenylprop-2-enyl]spiro[2H-indole-3,1'-cyclohexane]-1-yl]methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CC2(CCC(C/C=C/c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C28H27ClN2O/c29-26-19-23(15-18-30-26)27(32)31-20-28(24-11-4-5-12-25(24)31)16-13-22(14-17-28)10-6-9-21-7-2-1-3-8-21/h1-9,11-12,15,18-19,22H,10,13-14,16-17,20H2/b9-6+ |
| InChIKey | BBGTXMKGNZADHB-RMKNXTFCSA-N |
| XLogP | 6.93 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|