C18H18Cl2FN3O — CID 87375659
(2-chloro-4-pyridinyl)-(5-fluorospiro[2H-indole-3,4'-piperidin-1-ium]-1-yl)methanone chloride (PubChem CID 87375659) has the molecular formula C18H18Cl2FN3O and a molecular weight of 382.27 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-(5-fluorospiro[2H-indole-3,4'-piperidin-1-ium]-1-yl)methanone chloride.
| Compound Name | (2-chloro-4-pyridinyl)-(5-fluorospiro[2H-indole-3,4'-piperidin-1-ium]-1-yl)methanone chloride |
|---|---|
| PubChem CID | 87375659 |
| Molecular Formula | C18H18Cl2FN3O |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (2-chloro-4-pyridinyl)-(5-fluorospiro[2H-indole-3,4'-piperidin-1-ium]-1-yl)methanone chloride |
| SMILES | O=C(c1ccnc(Cl)c1)N1CC2(CC[NH2+]CC2)c2cc(F)ccc21.[Cl-] |
| InChI | InChI=1S/C18H17ClFN3O.ClH/c19-16-9-12(3-6-22-16)17(24)23-11-18(4-7-21-8-5-18)14-10-13(20)1-2-15(14)23;/h1-3,6,9-10,21H,4-5,7-8,11H2;1H |
| InChIKey | CUSPQCHIEFXIBU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|