C27H25ClFN3O3 — CID 23855468
methyl 4-[[1-(2-chloropyridine-4-carbonyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]methyl]benzoate (PubChem CID 23855468) has the molecular formula C27H25ClFN3O3 and a molecular weight of 493.97 g/mol. Its IUPAC name is methyl 4-[[1-(2-chloropyridine-4-carbonyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]methyl]benzoate.
| Compound Name | methyl 4-[[1-(2-chloropyridine-4-carbonyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]methyl]benzoate |
|---|---|
| PubChem CID | 23855468 |
| Molecular Formula | C27H25ClFN3O3 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | methyl 4-[[1-(2-chloropyridine-4-carbonyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCC3(CC2)CN(C(=O)c2ccnc(Cl)c2)c2ccc(F)cc23)cc1 |
| InChI | InChI=1S/C27H25ClFN3O3/c1-35-26(34)19-4-2-18(3-5-19)16-31-12-9-27(10-13-31)17-32(23-7-6-21(29)15-22(23)27)25(33)20-8-11-30-24(28)14-20/h2-8,11,14-15H,9-10,12-13,16-17H2,1H3 |
| InChIKey | NWRDAQBOPVHPFR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|