C20H20ClF3N4O2 — CID 118195662
N-[(2-chloro-4-pyridinyl)methyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1-carboxamide (PubChem CID 118195662) has the molecular formula C20H20ClF3N4O2 and a molecular weight of 440.85 g/mol. Its IUPAC name is N-[(2-chloro-4-pyridinyl)methyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1-carboxamide.
| Compound Name | N-[(2-chloro-4-pyridinyl)methyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 118195662 |
| Molecular Formula | C20H20ClF3N4O2 |
| Molecular Weight | 440.85 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[(2-chloro-4-pyridinyl)methyl]-5-(trifluoromethoxy)spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
| SMILES | O=C(NCc1ccnc(Cl)c1)N1CC2(CCNCC2)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H20ClF3N4O2/c21-17-9-13(3-6-26-17)11-27-18(29)28-12-19(4-7-25-8-5-19)15-10-14(1-2-16(15)28)30-20(22,23)24/h1-3,6,9-10,25H,4-5,7-8,11-12H2,(H,27,29) |
| InChIKey | DOXYMFUSWGKHRA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|