About methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate
methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate (PubChem CID 90464018) has the molecular formula C13H15ClN2O2
and a molecular weight of 266.73 g/mol. Its IUPAC name is methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate |
| PubChem CID | 90464018 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate |
| SMILES | COC(=O)N1CC[C@]2(CNc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C13H15ClN2O2/c1-18-12(17)16-5-4-13(8-16)7-15-11-3-2-9(14)6-10(11)13/h2-3,6,15H,4-5,7-8H2,1H3/t13-/m0/s1 |
| InChIKey | GJTXMMVMBYQRAE-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate?
The IUPAC name of methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate (CID 90464018) is methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate.
What is the SMILES notation for methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate?
The canonical SMILES for methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate is COC(=O)N1CC[C@]2(CNc3ccc(Cl)cc32)C1.
What is the InChIKey of methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate?
The InChIKey is GJTXMMVMBYQRAE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H15ClN2O2/c1-18-12(17)16-5-4-13(8-16)7-15-11-3-2-9(14)6-10(11)13/h2-3,6,15H,4-5,7-8H2,1H3/t13-/m0/s1.
What are the key properties of methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate?
methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate has a molecular weight of 266.73 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-5-chlorospiro[1,2-dihydroindole-3,3'-pyrrolidine]-1'-carboxylate is sourced from PubChem (CID 90464018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).