C17H20F4N2O2 — CID 118788787
1-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 118788787) has the molecular formula C17H20F4N2O2 and a molecular weight of 360.35 g/mol. Its IUPAC name is 1-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 118788787 |
| Molecular Formula | C17H20F4N2O2 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | O=C(COCC(F)(F)C(F)F)N1CCC2(CC1)CNc1ccccc12 |
| InChI | InChI=1S/C17H20F4N2O2/c18-15(19)17(20,21)11-25-9-14(24)23-7-5-16(6-8-23)10-22-13-4-2-1-3-12(13)16/h1-4,15,22H,5-11H2 |
| InChIKey | HDUYWNTUFBBMMH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|