C12H17F4N5O2 — CID 90652940
2-(2,2,3,3-tetrafluoropropoxy)-1-[4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 90652940) has the molecular formula C12H17F4N5O2 and a molecular weight of 339.29 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxy)-1-[4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxy)-1-[4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90652940 |
| Molecular Formula | C12H17F4N5O2 |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxy)-1-[4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(COCC(F)(F)C(F)F)N1CCN(Cc2ncn[nH]2)CC1 |
| InChI | InChI=1S/C12H17F4N5O2/c13-11(14)12(15,16)7-23-6-10(22)21-3-1-20(2-4-21)5-9-17-8-18-19-9/h8,11H,1-7H2,(H,17,18,19) |
| InChIKey | ILIYIVZADUMOSI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|