C17H24F4N2O3 — CID 97157021
(5R)-7-(cyclopropylmethyl)-2-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97157021) has the molecular formula C17H24F4N2O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is (5R)-7-(cyclopropylmethyl)-2-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5R)-7-(cyclopropylmethyl)-2-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97157021 |
| Molecular Formula | C17H24F4N2O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (5R)-7-(cyclopropylmethyl)-2-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C(COCC(F)(F)C(F)F)N1CC[C@]2(CCCN(CC3CC3)C2=O)C1 |
| InChI | InChI=1S/C17H24F4N2O3/c18-14(19)17(20,21)11-26-9-13(24)23-7-5-16(10-23)4-1-6-22(15(16)25)8-12-2-3-12/h12,14H,1-11H2/t16-/m1/s1 |
| InChIKey | SQFZZMDNZFPEAX-MRXNPFEDSA-N |
| XLogP | 2.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|