C14H19NOS — CID 115099661
8-methoxyspiro[4,5-dihydro-2H-1,5-benzothiazepine-3,1'-cyclopentane] (PubChem CID 115099661) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 8-methoxyspiro[4,5-dihydro-2H-1,5-benzothiazepine-3,1'-cyclopentane].
| Compound Name | 8-methoxyspiro[4,5-dihydro-2H-1,5-benzothiazepine-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 115099661 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 8-methoxyspiro[4,5-dihydro-2H-1,5-benzothiazepine-3,1'-cyclopentane] |
| SMILES | COc1ccc2c(c1)SCC1(CCCC1)CN2 |
| InChI | InChI=1S/C14H19NOS/c1-16-11-4-5-12-13(8-11)17-10-14(9-15-12)6-2-3-7-14/h4-5,8,15H,2-3,6-7,9-10H2,1H3 |
| InChIKey | JOKCDUZHPFXHBY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|