C15H21NO2 — CID 115099862
8-methoxyspiro[4,5-dihydro-2H-1,5-benzoxazepine-3,1'-cyclohexane] (PubChem CID 115099862) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 8-methoxyspiro[4,5-dihydro-2H-1,5-benzoxazepine-3,1'-cyclohexane].
| Compound Name | 8-methoxyspiro[4,5-dihydro-2H-1,5-benzoxazepine-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 115099862 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 8-methoxyspiro[4,5-dihydro-2H-1,5-benzoxazepine-3,1'-cyclohexane] |
| SMILES | COc1ccc2c(c1)OCC1(CCCCC1)CN2 |
| InChI | InChI=1S/C15H21NO2/c1-17-12-5-6-13-14(9-12)18-11-15(10-16-13)7-3-2-4-8-15/h5-6,9,16H,2-4,7-8,10-11H2,1H3 |
| InChIKey | SRVOGPVJZWXMOD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|