C35H36N4O8 — CID 134462458
7,7',19,19'-tetramethoxy-13,13'-spirobi[11,15-dioxa-2,4-diazatricyclo[14.4.0.05,10]icosa-1(16),2,5(10),6,8,17,19-heptaene] (PubChem CID 134462458) has the molecular formula C35H36N4O8 and a molecular weight of 640.69 g/mol. Its IUPAC name is 7,7',19,19'-tetramethoxy-13,13'-spirobi[11,15-dioxa-2,4-diazatricyclo[14.4.0.05,10]icosa-1(16),2,5(10),6,8,17,19-heptaene].
| Compound Name | 7,7',19,19'-tetramethoxy-13,13'-spirobi[11,15-dioxa-2,4-diazatricyclo[14.4.0.05,10]icosa-1(16),2,5(10),6,8,17,19-heptaene] |
|---|---|
| PubChem CID | 134462458 |
| Molecular Formula | C35H36N4O8 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | 7,7',19,19'-tetramethoxy-13,13'-spirobi[11,15-dioxa-2,4-diazatricyclo[14.4.0.05,10]icosa-1(16),2,5(10),6,8,17,19-heptaene] |
| SMILES | COc1ccc2c(c1)/N=C\Nc1cc(OC)ccc1OCC1(CO2)COc2ccc(OC)cc2/N=C/Nc2cc(OC)ccc2OC1 |
| InChI | InChI=1S/C35H36N4O8/c1-40-23-5-9-31-27(13-23)36-21-37-28-14-24(41-2)6-10-32(28)45-18-35(17-44-31)19-46-33-11-7-25(42-3)15-29(33)38-22-39-30-16-26(43-4)8-12-34(30)47-20-35/h5-16,21-22H,17-20H2,1-4H3,(H,36,37)(H,38,39) |
| InChIKey | OHJNUUCIUZSENY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |